About N-(3,4-dihydro-2H-chromen-4-yl)-1-ethyl-N-(3-methoxypropyl)pyrazole-4-sulfonamide
N-(3,4-dihydro-2H-chromen-4-yl)-1-ethyl-N-(3-methoxypropyl)pyrazole-4-sulfonamide (PubChem CID 46966755) has the molecular formula C18H25N3O4S
and a molecular weight of 379.48 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-chromen-4-yl)-1-ethyl-N-(3-methoxypropyl)pyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-(3,4-dihydro-2H-chromen-4-yl)-1-ethyl-N-(3-methoxypropyl)pyrazole-4-sulfonamide |
| PubChem CID | 46966755 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N-(3,4-dihydro-2H-chromen-4-yl)-1-ethyl-N-(3-methoxypropyl)pyrazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)N(CCCOC)C2CCOc3ccccc32)cn1 |
| InChI | InChI=1S/C18H25N3O4S/c1-3-20-14-15(13-19-20)26(22,23)21(10-6-11-24-2)17-9-12-25-18-8-5-4-7-16(17)18/h4-5,7-8,13-14,17H,3,6,9-12H2,1-2H3 |
| InChIKey | SRHJCCYPGLPNJQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3,4-dihydro-2H-chromen-4-yl)-1-ethyl-N-(3-methoxypropyl)pyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dihydro-2H-chromen-4-yl)-1-ethyl-N-(3-methoxypropyl)pyrazole-4-sulfonamide?
The IUPAC name of N-(3,4-dihydro-2H-chromen-4-yl)-1-ethyl-N-(3-methoxypropyl)pyrazole-4-sulfonamide (CID 46966755) is N-(3,4-dihydro-2H-chromen-4-yl)-1-ethyl-N-(3-methoxypropyl)pyrazole-4-sulfonamide.
What is the SMILES notation for N-(3,4-dihydro-2H-chromen-4-yl)-1-ethyl-N-(3-methoxypropyl)pyrazole-4-sulfonamide?
The canonical SMILES for N-(3,4-dihydro-2H-chromen-4-yl)-1-ethyl-N-(3-methoxypropyl)pyrazole-4-sulfonamide is CCn1cc(S(=O)(=O)N(CCCOC)C2CCOc3ccccc32)cn1.
What is the InChIKey of N-(3,4-dihydro-2H-chromen-4-yl)-1-ethyl-N-(3-methoxypropyl)pyrazole-4-sulfonamide?
The InChIKey is SRHJCCYPGLPNJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25N3O4S/c1-3-20-14-15(13-19-20)26(22,23)21(10-6-11-24-2)17-9-12-25-18-8-5-4-7-16(17)18/h4-5,7-8,13-14,17H,3,6,9-12H2,1-2H3.
What are the key properties of N-(3,4-dihydro-2H-chromen-4-yl)-1-ethyl-N-(3-methoxypropyl)pyrazole-4-sulfonamide?
N-(3,4-dihydro-2H-chromen-4-yl)-1-ethyl-N-(3-methoxypropyl)pyrazole-4-sulfonamide has a molecular weight of 379.48 g/mol, XLogP of 2.45, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dihydro-2H-chromen-4-yl)-1-ethyl-N-(3-methoxypropyl)pyrazole-4-sulfonamide is sourced from PubChem (CID 46966755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).