About [(4R)-3,4-dihydro-2H-chromen-4-yl]-(3-methoxypropyl)azanium
[(4R)-3,4-dihydro-2H-chromen-4-yl]-(3-methoxypropyl)azanium (PubChem CID 7287153) has the molecular formula C13H20NO2+
and a molecular weight of 222.31 g/mol. Its IUPAC name is [(4R)-3,4-dihydro-2H-chromen-4-yl]-(3-methoxypropyl)azanium.
Molecular Properties
| Compound Name | [(4R)-3,4-dihydro-2H-chromen-4-yl]-(3-methoxypropyl)azanium |
| PubChem CID | 7287153 |
| Molecular Formula | C13H20NO2+ |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | [(4R)-3,4-dihydro-2H-chromen-4-yl]-(3-methoxypropyl)azanium |
| SMILES | COCCC[NH2+][C@@H]1CCOc2ccccc21 |
| InChI | InChI=1S/C13H19NO2/c1-15-9-4-8-14-12-7-10-16-13-6-3-2-5-11(12)13/h2-3,5-6,12,14H,4,7-10H2,1H3/p+1/t12-/m1/s1 |
| InChIKey | FTPVIPPRGOQALE-GFCCVEGCSA-O |
| XLogP | 1.11 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(4R)-3,4-dihydro-2H-chromen-4-yl]-(3-methoxypropyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4R)-3,4-dihydro-2H-chromen-4-yl]-(3-methoxypropyl)azanium?
The IUPAC name of [(4R)-3,4-dihydro-2H-chromen-4-yl]-(3-methoxypropyl)azanium (CID 7287153) is [(4R)-3,4-dihydro-2H-chromen-4-yl]-(3-methoxypropyl)azanium.
What is the SMILES notation for [(4R)-3,4-dihydro-2H-chromen-4-yl]-(3-methoxypropyl)azanium?
The canonical SMILES for [(4R)-3,4-dihydro-2H-chromen-4-yl]-(3-methoxypropyl)azanium is COCCC[NH2+][C@@H]1CCOc2ccccc21.
What is the InChIKey of [(4R)-3,4-dihydro-2H-chromen-4-yl]-(3-methoxypropyl)azanium?
The InChIKey is FTPVIPPRGOQALE-GFCCVEGCSA-O. The full InChI is InChI=1S/C13H19NO2/c1-15-9-4-8-14-12-7-10-16-13-6-3-2-5-11(12)13/h2-3,5-6,12,14H,4,7-10H2,1H3/p+1/t12-/m1/s1.
What are the key properties of [(4R)-3,4-dihydro-2H-chromen-4-yl]-(3-methoxypropyl)azanium?
[(4R)-3,4-dihydro-2H-chromen-4-yl]-(3-methoxypropyl)azanium has a molecular weight of 222.31 g/mol, XLogP of 1.11, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(4R)-3,4-dihydro-2H-chromen-4-yl]-(3-methoxypropyl)azanium is sourced from PubChem (CID 7287153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).