C22H34F3N3O3 — CID 119036270
tert-butyl N-[5-methoxy-4-[[1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl]amino]pentyl]carbamate (PubChem CID 119036270) has the molecular formula C22H34F3N3O3 and a molecular weight of 445.53 g/mol. Its IUPAC name is tert-butyl N-[5-methoxy-4-[[1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl]amino]pentyl]carbamate.
| Compound Name | tert-butyl N-[5-methoxy-4-[[1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl]amino]pentyl]carbamate |
|---|---|
| PubChem CID | 119036270 |
| Molecular Formula | C22H34F3N3O3 |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | tert-butyl N-[5-methoxy-4-[[1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl]amino]pentyl]carbamate |
| SMILES | COCC(CCCNC(=O)OC(C)(C)C)NC1CCN(c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C22H34F3N3O3/c1-21(2,3)31-20(29)26-12-5-6-18(15-30-4)27-17-11-13-28(14-17)19-9-7-16(8-10-19)22(23,24)25/h7-10,17-18,27H,5-6,11-15H2,1-4H3,(H,26,29) |
| InChIKey | NEGZSWKQGPVOFX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|