C19H33NO3 — CID 119038613
(3-butoxy-2,2-dimethylcyclobutyl) 1-cyclopropylpiperidine-4-carboxylate (PubChem CID 119038613) has the molecular formula C19H33NO3 and a molecular weight of 323.48 g/mol. Its IUPAC name is (3-butoxy-2,2-dimethylcyclobutyl) 1-cyclopropylpiperidine-4-carboxylate.
| Compound Name | (3-butoxy-2,2-dimethylcyclobutyl) 1-cyclopropylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 119038613 |
| Molecular Formula | C19H33NO3 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.25 |
| IUPAC Name | (3-butoxy-2,2-dimethylcyclobutyl) 1-cyclopropylpiperidine-4-carboxylate |
| SMILES | CCCCOC1CC(OC(=O)C2CCN(C3CC3)CC2)C1(C)C |
| InChI | InChI=1S/C19H33NO3/c1-4-5-12-22-16-13-17(19(16,2)3)23-18(21)14-8-10-20(11-9-14)15-6-7-15/h14-17H,4-13H2,1-3H3 |
| InChIKey | MZIBNLJKKZJNAR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|