C19H34N2O4 — CID 97098567
[(1S,3R)-3-butoxy-2,2-dimethylcyclobutyl] 1-(dimethylcarbamoyl)piperidine-4-carboxylate (PubChem CID 97098567) has the molecular formula C19H34N2O4 and a molecular weight of 354.49 g/mol. Its IUPAC name is [(1S,3R)-3-butoxy-2,2-dimethylcyclobutyl] 1-(dimethylcarbamoyl)piperidine-4-carboxylate.
| Compound Name | [(1S,3R)-3-butoxy-2,2-dimethylcyclobutyl] 1-(dimethylcarbamoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 97098567 |
| Molecular Formula | C19H34N2O4 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.25 |
| IUPAC Name | [(1S,3R)-3-butoxy-2,2-dimethylcyclobutyl] 1-(dimethylcarbamoyl)piperidine-4-carboxylate |
| SMILES | CCCCO[C@@H]1C[C@H](OC(=O)C2CCN(C(=O)N(C)C)CC2)C1(C)C |
| InChI | InChI=1S/C19H34N2O4/c1-6-7-12-24-15-13-16(19(15,2)3)25-17(22)14-8-10-21(11-9-14)18(23)20(4)5/h14-16H,6-13H2,1-5H3/t15-,16+/m1/s1 |
| InChIKey | NIGCSRUZDWMFHU-CVEARBPZSA-N |
| XLogP | 2.91 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|