C17H31NO3 — CID 122031836
4-[(3-butoxy-2,2-dimethylcyclobutyl)amino]cyclohexane-1-carboxylic acid (PubChem CID 122031836) has the molecular formula C17H31NO3 and a molecular weight of 297.44 g/mol. Its IUPAC name is 4-[(3-butoxy-2,2-dimethylcyclobutyl)amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(3-butoxy-2,2-dimethylcyclobutyl)amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122031836 |
| Molecular Formula | C17H31NO3 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | 4-[(3-butoxy-2,2-dimethylcyclobutyl)amino]cyclohexane-1-carboxylic acid |
| SMILES | CCCCOC1CC(NC2CCC(C(=O)O)CC2)C1(C)C |
| InChI | InChI=1S/C17H31NO3/c1-4-5-10-21-15-11-14(17(15,2)3)18-13-8-6-12(7-9-13)16(19)20/h12-15,18H,4-11H2,1-3H3,(H,19,20) |
| InChIKey | VJKLCIKYFPBRIR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|