C15H28N2O2 — CID 129423806
(3S)-3-[[(1R,3R)-3-butoxy-2,2-dimethylcyclobutyl]amino]-1-methylpyrrolidin-2-one (PubChem CID 129423806) has the molecular formula C15H28N2O2 and a molecular weight of 268.40 g/mol. Its IUPAC name is (3S)-3-[[(1R,3R)-3-butoxy-2,2-dimethylcyclobutyl]amino]-1-methylpyrrolidin-2-one.
| Compound Name | (3S)-3-[[(1R,3R)-3-butoxy-2,2-dimethylcyclobutyl]amino]-1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 129423806 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | (3S)-3-[[(1R,3R)-3-butoxy-2,2-dimethylcyclobutyl]amino]-1-methylpyrrolidin-2-one |
| SMILES | CCCCO[C@@H]1C[C@@H](N[C@H]2CCN(C)C2=O)C1(C)C |
| InChI | InChI=1S/C15H28N2O2/c1-5-6-9-19-13-10-12(15(13,2)3)16-11-7-8-17(4)14(11)18/h11-13,16H,5-10H2,1-4H3/t11-,12+,13+/m0/s1 |
| InChIKey | PYFLVOMQWNGHTF-YNEHKIRRSA-N |
| XLogP | 1.79 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|