C16H28N4O — CID 124777137
(8S)-N-[(1R,3R)-3-butoxy-2,2-dimethylcyclobutyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine (PubChem CID 124777137) has the molecular formula C16H28N4O and a molecular weight of 292.43 g/mol. Its IUPAC name is (8S)-N-[(1R,3R)-3-butoxy-2,2-dimethylcyclobutyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine.
| Compound Name | (8S)-N-[(1R,3R)-3-butoxy-2,2-dimethylcyclobutyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
|---|---|
| PubChem CID | 124777137 |
| Molecular Formula | C16H28N4O |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | (8S)-N-[(1R,3R)-3-butoxy-2,2-dimethylcyclobutyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
| SMILES | CCCCO[C@@H]1C[C@@H](N[C@H]2CCCn3ncnc32)C1(C)C |
| InChI | InChI=1S/C16H28N4O/c1-4-5-9-21-14-10-13(16(14,2)3)19-12-7-6-8-20-15(12)17-11-18-20/h11-14,19H,4-10H2,1-3H3/t12-,13+,14+/m0/s1 |
| InChIKey | KUPGEIJYBZNBGD-BFHYXJOUSA-N |
| XLogP | 2.69 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|