C19H25N3O6S — CID 119039462
(2S)-N-methyl-1-[2-oxo-2-[4-(oxolan-2-ylmethylsulfonyl)anilino]acetyl]pyrrolidine-2-carboxamide (PubChem CID 119039462) has the molecular formula C19H25N3O6S and a molecular weight of 423.49 g/mol. Its IUPAC name is (2S)-N-methyl-1-[2-oxo-2-[4-(oxolan-2-ylmethylsulfonyl)anilino]acetyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-methyl-1-[2-oxo-2-[4-(oxolan-2-ylmethylsulfonyl)anilino]acetyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 119039462 |
| Molecular Formula | C19H25N3O6S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | (2S)-N-methyl-1-[2-oxo-2-[4-(oxolan-2-ylmethylsulfonyl)anilino]acetyl]pyrrolidine-2-carboxamide |
| SMILES | CNC(=O)[C@@H]1CCCN1C(=O)C(=O)Nc1ccc(S(=O)(=O)CC2CCCO2)cc1 |
| InChI | InChI=1S/C19H25N3O6S/c1-20-17(23)16-5-2-10-22(16)19(25)18(24)21-13-6-8-15(9-7-13)29(26,27)12-14-4-3-11-28-14/h6-9,14,16H,2-5,10-12H2,1H3,(H,20,23)(H,21,24)/t14?,16-/m0/s1 |
| InChIKey | FSAKKPBHNPPDQM-WMCAAGNKSA-N |
| XLogP | 0.31 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|