C13H15F2NO4S — CID 146090869
2,2-difluoro-N-[4-(oxolan-2-ylmethylsulfonyl)phenyl]acetamide (PubChem CID 146090869) has the molecular formula C13H15F2NO4S and a molecular weight of 319.33 g/mol. Its IUPAC name is 2,2-difluoro-N-[4-(oxolan-2-ylmethylsulfonyl)phenyl]acetamide.
| Compound Name | 2,2-difluoro-N-[4-(oxolan-2-ylmethylsulfonyl)phenyl]acetamide |
|---|---|
| PubChem CID | 146090869 |
| Molecular Formula | C13H15F2NO4S |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 2,2-difluoro-N-[4-(oxolan-2-ylmethylsulfonyl)phenyl]acetamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)CC2CCCO2)cc1)C(F)F |
| InChI | InChI=1S/C13H15F2NO4S/c14-12(15)13(17)16-9-3-5-11(6-4-9)21(18,19)8-10-2-1-7-20-10/h3-6,10,12H,1-2,7-8H2,(H,16,17) |
| InChIKey | VHWZJAZVYLKLHQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |