About (4-methyl-2,3-dihydroquinoxalin-1-yl)-(6-pyrazol-1-yl-2-pyridinyl)methanone
(4-methyl-2,3-dihydroquinoxalin-1-yl)-(6-pyrazol-1-yl-2-pyridinyl)methanone (PubChem CID 119041898) has the molecular formula C18H17N5O
and a molecular weight of 319.37 g/mol. Its IUPAC name is (4-methyl-2,3-dihydroquinoxalin-1-yl)-(6-pyrazol-1-yl-2-pyridinyl)methanone.
Molecular Properties
| Compound Name | (4-methyl-2,3-dihydroquinoxalin-1-yl)-(6-pyrazol-1-yl-2-pyridinyl)methanone |
| PubChem CID | 119041898 |
| Molecular Formula | C18H17N5O |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | (4-methyl-2,3-dihydroquinoxalin-1-yl)-(6-pyrazol-1-yl-2-pyridinyl)methanone |
| SMILES | CN1CCN(C(=O)c2cccc(-n3cccn3)n2)c2ccccc21 |
| InChI | InChI=1S/C18H17N5O/c1-21-12-13-22(16-8-3-2-7-15(16)21)18(24)14-6-4-9-17(20-14)23-11-5-10-19-23/h2-11H,12-13H2,1H3 |
| InChIKey | KCYPXZVQZAPLIE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-methyl-2,3-dihydroquinoxalin-1-yl)-(6-pyrazol-1-yl-2-pyridinyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-2,3-dihydroquinoxalin-1-yl)-(6-pyrazol-1-yl-2-pyridinyl)methanone?
The IUPAC name of (4-methyl-2,3-dihydroquinoxalin-1-yl)-(6-pyrazol-1-yl-2-pyridinyl)methanone (CID 119041898) is (4-methyl-2,3-dihydroquinoxalin-1-yl)-(6-pyrazol-1-yl-2-pyridinyl)methanone.
What is the SMILES notation for (4-methyl-2,3-dihydroquinoxalin-1-yl)-(6-pyrazol-1-yl-2-pyridinyl)methanone?
The canonical SMILES for (4-methyl-2,3-dihydroquinoxalin-1-yl)-(6-pyrazol-1-yl-2-pyridinyl)methanone is CN1CCN(C(=O)c2cccc(-n3cccn3)n2)c2ccccc21.
What is the InChIKey of (4-methyl-2,3-dihydroquinoxalin-1-yl)-(6-pyrazol-1-yl-2-pyridinyl)methanone?
The InChIKey is KCYPXZVQZAPLIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N5O/c1-21-12-13-22(16-8-3-2-7-15(16)21)18(24)14-6-4-9-17(20-14)23-11-5-10-19-23/h2-11H,12-13H2,1H3.
What are the key properties of (4-methyl-2,3-dihydroquinoxalin-1-yl)-(6-pyrazol-1-yl-2-pyridinyl)methanone?
(4-methyl-2,3-dihydroquinoxalin-1-yl)-(6-pyrazol-1-yl-2-pyridinyl)methanone has a molecular weight of 319.37 g/mol, XLogP of 2.36, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-2,3-dihydroquinoxalin-1-yl)-(6-pyrazol-1-yl-2-pyridinyl)methanone is sourced from PubChem (CID 119041898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).