C18H20N6O — CID 119053049
1-(2-methyl-5-pyridin-3-ylphenyl)-3-[3-(1H-1,2,4-triazol-5-yl)propyl]urea (PubChem CID 119053049) has the molecular formula C18H20N6O and a molecular weight of 336.40 g/mol. Its IUPAC name is 1-(2-methyl-5-pyridin-3-ylphenyl)-3-[3-(1H-1,2,4-triazol-5-yl)propyl]urea.
| Compound Name | 1-(2-methyl-5-pyridin-3-ylphenyl)-3-[3-(1H-1,2,4-triazol-5-yl)propyl]urea |
|---|---|
| PubChem CID | 119053049 |
| Molecular Formula | C18H20N6O |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 1-(2-methyl-5-pyridin-3-ylphenyl)-3-[3-(1H-1,2,4-triazol-5-yl)propyl]urea |
| SMILES | Cc1ccc(-c2cccnc2)cc1NC(=O)NCCCc1ncn[nH]1 |
| InChI | InChI=1S/C18H20N6O/c1-13-6-7-14(15-4-2-8-19-11-15)10-16(13)23-18(25)20-9-3-5-17-21-12-22-24-17/h2,4,6-8,10-12H,3,5,9H2,1H3,(H2,20,23,25)(H,21,22,24) |
| InChIKey | MPZYXXJWASGIFI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|