C16H19N3O3S2 — CID 119059665
1-benzyl-3-(1,1-dioxothiolan-3-yl)-1-(1,3-thiazol-2-ylmethyl)urea (PubChem CID 119059665) has the molecular formula C16H19N3O3S2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 1-benzyl-3-(1,1-dioxothiolan-3-yl)-1-(1,3-thiazol-2-ylmethyl)urea.
| Compound Name | 1-benzyl-3-(1,1-dioxothiolan-3-yl)-1-(1,3-thiazol-2-ylmethyl)urea |
|---|---|
| PubChem CID | 119059665 |
| Molecular Formula | C16H19N3O3S2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 1-benzyl-3-(1,1-dioxothiolan-3-yl)-1-(1,3-thiazol-2-ylmethyl)urea |
| SMILES | O=C(NC1CCS(=O)(=O)C1)N(Cc1ccccc1)Cc1nccs1 |
| InChI | InChI=1S/C16H19N3O3S2/c20-16(18-14-6-9-24(21,22)12-14)19(11-15-17-7-8-23-15)10-13-4-2-1-3-5-13/h1-5,7-8,14H,6,9-12H2,(H,18,20) |
| InChIKey | NNVJPNFOSLEDNC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |