C20H22N4O2S — CID 119070803
N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-4-(3-methoxypyrazin-2-yl)benzamide (PubChem CID 119070803) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-4-(3-methoxypyrazin-2-yl)benzamide.
| Compound Name | N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-4-(3-methoxypyrazin-2-yl)benzamide |
|---|---|
| PubChem CID | 119070803 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-4-(3-methoxypyrazin-2-yl)benzamide |
| SMILES | COc1nccnc1-c1ccc(C(=O)NCC(c2cccs2)N(C)C)cc1 |
| InChI | InChI=1S/C20H22N4O2S/c1-24(2)16(17-5-4-12-27-17)13-23-19(25)15-8-6-14(7-9-15)18-20(26-3)22-11-10-21-18/h4-12,16H,13H2,1-3H3,(H,23,25) |
| InChIKey | RUHJDQGMZWNYRT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |