About CID 119079827
CID 119079827 (PubChem CID 119079827) has the molecular formula C24H28BNP
and a molecular weight of 372.28 g/mol.
Molecular Properties
| Compound Name | CID 119079827 |
| PubChem CID | 119079827 |
| Molecular Formula | C24H28BNP |
| Molecular Weight | 372.28 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | — |
| SMILES | CC(C)N([B]c1ccccc1P(c1ccccc1)c1ccccc1)C(C)C |
| InChI | InChI=1S/C24H28BNP/c1-19(2)26(20(3)4)25-23-17-11-12-18-24(23)27(21-13-7-5-8-14-21)22-15-9-6-10-16-22/h5-20H,1-4H3 |
| InChIKey | CPZVBWQULPEFLM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.28 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 119079827 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 119079827?
The IUPAC name of CID 119079827 (CID 119079827) is not available.
What is the SMILES notation for CID 119079827?
The canonical SMILES for CID 119079827 is CC(C)N([B]c1ccccc1P(c1ccccc1)c1ccccc1)C(C)C.
What is the InChIKey of CID 119079827?
The InChIKey is CPZVBWQULPEFLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28BNP/c1-19(2)26(20(3)4)25-23-17-11-12-18-24(23)27(21-13-7-5-8-14-21)22-15-9-6-10-16-22/h5-20H,1-4H3.
What are the key properties of CID 119079827?
CID 119079827 has a molecular weight of 372.28 g/mol, XLogP of 3.81, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 119079827 is sourced from PubChem (CID 119079827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).