C20H12BrN3O3S — CID 119081264
N-[(E)-(3-bromophenyl)methylideneamino]-4-(2-oxochromen-3-yl)-1,3-thiazole-2-carboxamide (PubChem CID 119081264) has the molecular formula C20H12BrN3O3S and a molecular weight of 454.31 g/mol. Its IUPAC name is N-[(E)-(3-bromophenyl)methylideneamino]-4-(2-oxochromen-3-yl)-1,3-thiazole-2-carboxamide.
| Compound Name | N-[(E)-(3-bromophenyl)methylideneamino]-4-(2-oxochromen-3-yl)-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 119081264 |
| Molecular Formula | C20H12BrN3O3S |
| Molecular Weight | 454.31 g/mol |
| Exact Mass | 452.98 |
| IUPAC Name | N-[(E)-(3-bromophenyl)methylideneamino]-4-(2-oxochromen-3-yl)-1,3-thiazole-2-carboxamide |
| SMILES | O=C(N/N=C/c1cccc(Br)c1)c1nc(-c2cc3ccccc3oc2=O)cs1 |
| InChI | InChI=1S/C20H12BrN3O3S/c21-14-6-3-4-12(8-14)10-22-24-18(25)19-23-16(11-28-19)15-9-13-5-1-2-7-17(13)27-20(15)26/h1-11H,(H,24,25)/b22-10+ |
| InChIKey | LBNFOQAQBGEAFZ-LSHDLFTRSA-N |
| XLogP | 4.44 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.31 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|