C13H10N2OS — CID 119081786
4-(4-methyl-1,3-thiazol-2-yl)-2-phenyl-1,3-oxazole (PubChem CID 119081786) has the molecular formula C13H10N2OS and a molecular weight of 242.30 g/mol. Its IUPAC name is 4-(4-methyl-1,3-thiazol-2-yl)-2-phenyl-1,3-oxazole.
| Compound Name | 4-(4-methyl-1,3-thiazol-2-yl)-2-phenyl-1,3-oxazole |
|---|---|
| PubChem CID | 119081786 |
| Molecular Formula | C13H10N2OS |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 4-(4-methyl-1,3-thiazol-2-yl)-2-phenyl-1,3-oxazole |
| SMILES | Cc1csc(-c2coc(-c3ccccc3)n2)n1 |
| InChI | InChI=1S/C13H10N2OS/c1-9-8-17-13(14-9)11-7-16-12(15-11)10-5-3-2-4-6-10/h2-8H,1H3 |
| InChIKey | DBRZYLGUNBAKCC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |