C8H5N3 — CID 119084030
3H-pyrrolo[2,3-b]pyridine-5-carbonitrile (PubChem CID 119084030) has the molecular formula C8H5N3 and a molecular weight of 143.15 g/mol. Its IUPAC name is 3H-pyrrolo[2,3-b]pyridine-5-carbonitrile.
| Compound Name | 3H-pyrrolo[2,3-b]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 119084030 |
| Molecular Formula | C8H5N3 |
| Molecular Weight | 143.15 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | 3H-pyrrolo[2,3-b]pyridine-5-carbonitrile |
| SMILES | N#Cc1cnc2c(c1)CC=N2 |
| InChI | InChI=1S/C8H5N3/c9-4-6-3-7-1-2-10-8(7)11-5-6/h2-3,5H,1H2 |
| InChIKey | YVNWKSMKKYEZQC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 49.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.15 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |