About 7,8-dihydro-5H-pyrano[4,3-b]pyridine-3-carbonitrile
7,8-dihydro-5H-pyrano[4,3-b]pyridine-3-carbonitrile (PubChem CID 66815583) has the molecular formula C9H8N2O
and a molecular weight of 160.18 g/mol. Its IUPAC name is 7,8-dihydro-5H-pyrano[4,3-b]pyridine-3-carbonitrile.
Analyze 7,8-dihydro-5H-pyrano[4,3-b]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dihydro-5H-pyrano[4,3-b]pyridine-3-carbonitrile?
The IUPAC name of 7,8-dihydro-5H-pyrano[4,3-b]pyridine-3-carbonitrile (CID 66815583) is 7,8-dihydro-5H-pyrano[4,3-b]pyridine-3-carbonitrile.
What is the SMILES notation for 7,8-dihydro-5H-pyrano[4,3-b]pyridine-3-carbonitrile?
The canonical SMILES for 7,8-dihydro-5H-pyrano[4,3-b]pyridine-3-carbonitrile is N#Cc1cnc2c(c1)COCC2.
What is the InChIKey of 7,8-dihydro-5H-pyrano[4,3-b]pyridine-3-carbonitrile?
The InChIKey is JCPKQRRXIHMKFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O/c10-4-7-3-8-6-12-2-1-9(8)11-5-7/h3,5H,1-2,6H2.
What are the key properties of 7,8-dihydro-5H-pyrano[4,3-b]pyridine-3-carbonitrile?
7,8-dihydro-5H-pyrano[4,3-b]pyridine-3-carbonitrile has a molecular weight of 160.18 g/mol, XLogP of 1.03, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dihydro-5H-pyrano[4,3-b]pyridine-3-carbonitrile is sourced from PubChem (CID 66815583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).