C11H11BrFNO — CID 119087183
(E)-3-(3-bromo-4-fluorophenyl)-N,N-dimethylprop-2-enamide (PubChem CID 119087183) has the molecular formula C11H11BrFNO and a molecular weight of 272.12 g/mol. Its IUPAC name is (E)-3-(3-bromo-4-fluorophenyl)-N,N-dimethylprop-2-enamide.
| Compound Name | (E)-3-(3-bromo-4-fluorophenyl)-N,N-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 119087183 |
| Molecular Formula | C11H11BrFNO |
| Molecular Weight | 272.12 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | (E)-3-(3-bromo-4-fluorophenyl)-N,N-dimethylprop-2-enamide |
| SMILES | CN(C)C(=O)/C=C/c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C11H11BrFNO/c1-14(2)11(15)6-4-8-3-5-10(13)9(12)7-8/h3-7H,1-2H3/b6-4+ |
| InChIKey | AWPLQAMHTKEUOW-GQCTYLIASA-N |
| XLogP | 2.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.12 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|