C9H12Cl2N2 — CID 119088250
N-butyl-3,5-dichloropyridin-4-amine (PubChem CID 119088250) has the molecular formula C9H12Cl2N2 and a molecular weight of 219.12 g/mol. Its IUPAC name is N-butyl-3,5-dichloropyridin-4-amine.
| Compound Name | N-butyl-3,5-dichloropyridin-4-amine |
|---|---|
| PubChem CID | 119088250 |
| Molecular Formula | C9H12Cl2N2 |
| Molecular Weight | 219.12 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | N-butyl-3,5-dichloropyridin-4-amine |
| SMILES | CCCCNc1c(Cl)cncc1Cl |
| InChI | InChI=1S/C9H12Cl2N2/c1-2-3-4-13-9-7(10)5-12-6-8(9)11/h5-6H,2-4H2,1H3,(H,12,13) |
| InChIKey | FLTCKXJBQWJRMK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.12 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|