C9H5Cl2F2NO2 — CID 119091684
1-(2,2-dichloro-1,1-difluoroethoxy)-2-isocyanatobenzene (PubChem CID 119091684) has the molecular formula C9H5Cl2F2NO2 and a molecular weight of 268.05 g/mol. Its IUPAC name is 1-(2,2-dichloro-1,1-difluoroethoxy)-2-isocyanatobenzene.
| Compound Name | 1-(2,2-dichloro-1,1-difluoroethoxy)-2-isocyanatobenzene |
|---|---|
| PubChem CID | 119091684 |
| Molecular Formula | C9H5Cl2F2NO2 |
| Molecular Weight | 268.05 g/mol |
| Exact Mass | 266.97 |
| IUPAC Name | 1-(2,2-dichloro-1,1-difluoroethoxy)-2-isocyanatobenzene |
| SMILES | O=C=Nc1ccccc1OC(F)(F)C(Cl)Cl |
| InChI | InChI=1S/C9H5Cl2F2NO2/c10-8(11)9(12,13)16-7-4-2-1-3-6(7)14-5-15/h1-4,8H |
| InChIKey | HWPZMLGWTVZKJB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.05 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|