C12H13NOS — CID 119094112
(4-ethylphenyl)-(1,2-thiazol-5-yl)methanol (PubChem CID 119094112) has the molecular formula C12H13NOS and a molecular weight of 219.31 g/mol. Its IUPAC name is (4-ethylphenyl)-(1,2-thiazol-5-yl)methanol.
| Compound Name | (4-ethylphenyl)-(1,2-thiazol-5-yl)methanol |
|---|---|
| PubChem CID | 119094112 |
| Molecular Formula | C12H13NOS |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | (4-ethylphenyl)-(1,2-thiazol-5-yl)methanol |
| SMILES | CCc1ccc(C(O)c2ccns2)cc1 |
| InChI | InChI=1S/C12H13NOS/c1-2-9-3-5-10(6-4-9)12(14)11-7-8-13-15-11/h3-8,12,14H,2H2,1H3 |
| InChIKey | GRYADYZWIROOEB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |