About 4-iodopentan-2-ol
4-iodopentan-2-ol (PubChem CID 119096018) has the molecular formula C5H11IO
and a molecular weight of 214.05 g/mol. Its IUPAC name is 4-iodopentan-2-ol.
Molecular Properties
| Compound Name | 4-iodopentan-2-ol |
| PubChem CID | 119096018 |
| Molecular Formula | C5H11IO |
| Molecular Weight | 214.05 g/mol |
| Exact Mass | 213.99 |
| IUPAC Name | 4-iodopentan-2-ol |
| SMILES | CC(O)CC(C)I |
| InChI | InChI=1S/C5H11IO/c1-4(6)3-5(2)7/h4-5,7H,3H2,1-2H3 |
| InChIKey | NREJSKNTYBUMQY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.05 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-iodopentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iodopentan-2-ol?
The IUPAC name of 4-iodopentan-2-ol (CID 119096018) is 4-iodopentan-2-ol.
What is the SMILES notation for 4-iodopentan-2-ol?
The canonical SMILES for 4-iodopentan-2-ol is CC(O)CC(C)I.
What is the InChIKey of 4-iodopentan-2-ol?
The InChIKey is NREJSKNTYBUMQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11IO/c1-4(6)3-5(2)7/h4-5,7H,3H2,1-2H3.
What are the key properties of 4-iodopentan-2-ol?
4-iodopentan-2-ol has a molecular weight of 214.05 g/mol, XLogP of 1.58, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iodopentan-2-ol is sourced from PubChem (CID 119096018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).