About methyl 1,2-thiazol-3-yl carbonate
methyl 1,2-thiazol-3-yl carbonate (PubChem CID 119096302) has the molecular formula C5H5NO3S
and a molecular weight of 159.17 g/mol. Its IUPAC name is methyl 1,2-thiazol-3-yl carbonate.
Molecular Properties
| Compound Name | methyl 1,2-thiazol-3-yl carbonate |
| PubChem CID | 119096302 |
| Molecular Formula | C5H5NO3S |
| Molecular Weight | 159.17 g/mol |
| Exact Mass | 159.00 |
| IUPAC Name | methyl 1,2-thiazol-3-yl carbonate |
| SMILES | COC(=O)Oc1ccsn1 |
| InChI | InChI=1S/C5H5NO3S/c1-8-5(7)9-4-2-3-10-6-4/h2-3H,1H3 |
| InChIKey | QWCHQYONLKIRIA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.17 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 1,2-thiazol-3-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1,2-thiazol-3-yl carbonate?
The IUPAC name of methyl 1,2-thiazol-3-yl carbonate (CID 119096302) is methyl 1,2-thiazol-3-yl carbonate.
What is the SMILES notation for methyl 1,2-thiazol-3-yl carbonate?
The canonical SMILES for methyl 1,2-thiazol-3-yl carbonate is COC(=O)Oc1ccsn1.
What is the InChIKey of methyl 1,2-thiazol-3-yl carbonate?
The InChIKey is QWCHQYONLKIRIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO3S/c1-8-5(7)9-4-2-3-10-6-4/h2-3H,1H3.
What are the key properties of methyl 1,2-thiazol-3-yl carbonate?
methyl 1,2-thiazol-3-yl carbonate has a molecular weight of 159.17 g/mol, XLogP of 1.29, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1,2-thiazol-3-yl carbonate is sourced from PubChem (CID 119096302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).