C9H10N2O6S — CID 67749491
methyl [5-(methylsulfonylcarbamoyl)-2-pyridinyl] carbonate (PubChem CID 67749491) has the molecular formula C9H10N2O6S and a molecular weight of 274.25 g/mol. Its IUPAC name is methyl [5-(methylsulfonylcarbamoyl)-2-pyridinyl] carbonate.
| Compound Name | methyl [5-(methylsulfonylcarbamoyl)-2-pyridinyl] carbonate |
|---|---|
| PubChem CID | 67749491 |
| Molecular Formula | C9H10N2O6S |
| Molecular Weight | 274.25 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | methyl [5-(methylsulfonylcarbamoyl)-2-pyridinyl] carbonate |
| SMILES | COC(=O)Oc1ccc(C(=O)NS(C)(=O)=O)cn1 |
| InChI | InChI=1S/C9H10N2O6S/c1-16-9(13)17-7-4-3-6(5-10-7)8(12)11-18(2,14)15/h3-5H,1-2H3,(H,11,12) |
| InChIKey | DPUXFRBHZQKVMU-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.25 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |