About 4-chlorohex-5-enenitrile
4-chlorohex-5-enenitrile (PubChem CID 119097357) has the molecular formula C6H8ClN
and a molecular weight of 129.59 g/mol. Its IUPAC name is 4-chlorohex-5-enenitrile.
Molecular Properties
| Compound Name | 4-chlorohex-5-enenitrile |
| PubChem CID | 119097357 |
| Molecular Formula | C6H8ClN |
| Molecular Weight | 129.59 g/mol |
| Exact Mass | 129.03 |
| IUPAC Name | 4-chlorohex-5-enenitrile |
| SMILES | C=CC(Cl)CCC#N |
| InChI | InChI=1S/C6H8ClN/c1-2-6(7)4-3-5-8/h2,6H,1,3-4H2 |
| InChIKey | SDRAQPNFMYMFPE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.59 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-chlorohex-5-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chlorohex-5-enenitrile?
The IUPAC name of 4-chlorohex-5-enenitrile (CID 119097357) is 4-chlorohex-5-enenitrile.
What is the SMILES notation for 4-chlorohex-5-enenitrile?
The canonical SMILES for 4-chlorohex-5-enenitrile is C=CC(Cl)CCC#N.
What is the InChIKey of 4-chlorohex-5-enenitrile?
The InChIKey is SDRAQPNFMYMFPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8ClN/c1-2-6(7)4-3-5-8/h2,6H,1,3-4H2.
What are the key properties of 4-chlorohex-5-enenitrile?
4-chlorohex-5-enenitrile has a molecular weight of 129.59 g/mol, XLogP of 2.08, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chlorohex-5-enenitrile is sourced from PubChem (CID 119097357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).