C7H11ClO — CID 142805814
(1E)-5-chlorohepta-1,6-dien-1-ol (PubChem CID 142805814) has the molecular formula C7H11ClO and a molecular weight of 146.62 g/mol. Its IUPAC name is (1E)-5-chlorohepta-1,6-dien-1-ol.
| Compound Name | (1E)-5-chlorohepta-1,6-dien-1-ol |
|---|---|
| PubChem CID | 142805814 |
| Molecular Formula | C7H11ClO |
| Molecular Weight | 146.62 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | (1E)-5-chlorohepta-1,6-dien-1-ol |
| SMILES | C=CC(Cl)CC/C=C/O |
| InChI | InChI=1S/C7H11ClO/c1-2-7(8)5-3-4-6-9/h2,4,6-7,9H,1,3,5H2/b6-4+ |
| InChIKey | YJXBMDKQMIKMQF-GQCTYLIASA-N |
| XLogP | 2.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.62 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|