About (1E)-5-chlorohepta-1,6-dien-1-ol
(1E)-5-chlorohepta-1,6-dien-1-ol (PubChem CID 142805814) has the molecular formula C7H11ClO
and a molecular weight of 146.62 g/mol. Its IUPAC name is (1E)-5-chlorohepta-1,6-dien-1-ol.
Molecular Properties
| Compound Name | (1E)-5-chlorohepta-1,6-dien-1-ol |
| PubChem CID | 142805814 |
| Molecular Formula | C7H11ClO |
| Molecular Weight | 146.62 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | (1E)-5-chlorohepta-1,6-dien-1-ol |
| SMILES | C=CC(Cl)CC/C=C/O |
| InChI | InChI=1S/C7H11ClO/c1-2-7(8)5-3-4-6-9/h2,4,6-7,9H,1,3,5H2/b6-4+ |
| InChIKey | YJXBMDKQMIKMQF-GQCTYLIASA-N |
| XLogP | 2.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.62 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1E)-5-chlorohepta-1,6-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-5-chlorohepta-1,6-dien-1-ol?
The IUPAC name of (1E)-5-chlorohepta-1,6-dien-1-ol (CID 142805814) is (1E)-5-chlorohepta-1,6-dien-1-ol.
What is the SMILES notation for (1E)-5-chlorohepta-1,6-dien-1-ol?
The canonical SMILES for (1E)-5-chlorohepta-1,6-dien-1-ol is C=CC(Cl)CC/C=C/O.
What is the InChIKey of (1E)-5-chlorohepta-1,6-dien-1-ol?
The InChIKey is YJXBMDKQMIKMQF-GQCTYLIASA-N. The full InChI is InChI=1S/C7H11ClO/c1-2-7(8)5-3-4-6-9/h2,4,6-7,9H,1,3,5H2/b6-4+.
What are the key properties of (1E)-5-chlorohepta-1,6-dien-1-ol?
(1E)-5-chlorohepta-1,6-dien-1-ol has a molecular weight of 146.62 g/mol, XLogP of 2.63, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-5-chlorohepta-1,6-dien-1-ol is sourced from PubChem (CID 142805814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).