C7H10I2 — CID 173353545
1,5-diiodohepta-1,6-diene (PubChem CID 173353545) has the molecular formula C7H10I2 and a molecular weight of 347.97 g/mol. Its IUPAC name is 1,5-diiodohepta-1,6-diene.
| Compound Name | 1,5-diiodohepta-1,6-diene |
|---|---|
| PubChem CID | 173353545 |
| Molecular Formula | C7H10I2 |
| Molecular Weight | 347.97 g/mol |
| Exact Mass | 347.89 |
| IUPAC Name | 1,5-diiodohepta-1,6-diene |
| SMILES | C=CC(I)CCC=CI |
| InChI | InChI=1S/C7H10I2/c1-2-7(9)5-3-4-6-8/h2,4,6-7H,1,3,5H2 |
| InChIKey | DXSWRDFCZMHNLX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.97 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|