C14H17N3O5S — CID 119113438
(3S)-1-(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carbonyl)piperidine-3-carboxylic acid (PubChem CID 119113438) has the molecular formula C14H17N3O5S and a molecular weight of 339.37 g/mol. Its IUPAC name is (3S)-1-(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carbonyl)piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carbonyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119113438 |
| Molecular Formula | C14H17N3O5S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | (3S)-1-(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carbonyl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCN(C(=O)C2=CN3CCS(=O)(=O)N=C3C=C2)C1 |
| InChI | InChI=1S/C14H17N3O5S/c18-13(17-5-1-2-11(9-17)14(19)20)10-3-4-12-15-23(21,22)7-6-16(12)8-10/h3-4,8,11H,1-2,5-7,9H2,(H,19,20)/t11-/m0/s1 |
| InChIKey | CBWUKFRLDGLAEL-NSHDSACASA-N |
| XLogP | -0.19 |
| TPSA | 107.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |