C17H22IN3O3 — CID 119119292
methyl 5-[[[amino-(3,4-dimethylanilino)methylidene]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide (PubChem CID 119119292) has the molecular formula C17H22IN3O3 and a molecular weight of 443.29 g/mol. Its IUPAC name is methyl 5-[[[amino-(3,4-dimethylanilino)methylidene]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide.
| Compound Name | methyl 5-[[[amino-(3,4-dimethylanilino)methylidene]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 119119292 |
| Molecular Formula | C17H22IN3O3 |
| Molecular Weight | 443.29 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | methyl 5-[[[amino-(3,4-dimethylanilino)methylidene]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide |
| SMILES | COC(=O)c1cc(C/N=C(\N)Nc2ccc(C)c(C)c2)oc1C.I |
| InChI | InChI=1S/C17H21N3O3.HI/c1-10-5-6-13(7-11(10)2)20-17(18)19-9-14-8-15(12(3)23-14)16(21)22-4;/h5-8H,9H2,1-4H3,(H3,18,19,20);1H |
| InChIKey | VAQCSNDIHWEFIE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.29 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|