C16H20N4O — CID 122098074
2-[(2-cyclopropyl-1,3-oxazol-5-yl)methyl]-1-(3,4-dimethylphenyl)guanidine (PubChem CID 122098074) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-[(2-cyclopropyl-1,3-oxazol-5-yl)methyl]-1-(3,4-dimethylphenyl)guanidine.
| Compound Name | 2-[(2-cyclopropyl-1,3-oxazol-5-yl)methyl]-1-(3,4-dimethylphenyl)guanidine |
|---|---|
| PubChem CID | 122098074 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 2-[(2-cyclopropyl-1,3-oxazol-5-yl)methyl]-1-(3,4-dimethylphenyl)guanidine |
| SMILES | Cc1ccc(N/C(N)=N/Cc2cnc(C3CC3)o2)cc1C |
| InChI | InChI=1S/C16H20N4O/c1-10-3-6-13(7-11(10)2)20-16(17)19-9-14-8-18-15(21-14)12-4-5-12/h3,6-8,12H,4-5,9H2,1-2H3,(H3,17,19,20) |
| InChIKey | BOFHBZXWUHVAMX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|