C19H26N4O — CID 119131326
2-[[(cyclopropylamino)-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 119131326) has the molecular formula C19H26N4O and a molecular weight of 326.44 g/mol. Its IUPAC name is 2-[[(cyclopropylamino)-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(cyclopropylamino)-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 119131326 |
| Molecular Formula | C19H26N4O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 2-[[(cyclopropylamino)-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C/N=C(/NC1CC1)N1CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H26N4O/c1-22(2)18(24)14-20-19(21-17-8-9-17)23-12-10-16(11-13-23)15-6-4-3-5-7-15/h3-7,10,17H,8-9,11-14H2,1-2H3,(H,20,21) |
| InChIKey | YQGMIAKZVMOMAN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|