C20H28N4O4 — CID 119131964
N'-(1,3-benzodioxol-4-ylmethyl)-N-ethyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide (PubChem CID 119131964) has the molecular formula C20H28N4O4 and a molecular weight of 388.47 g/mol. Its IUPAC name is N'-(1,3-benzodioxol-4-ylmethyl)-N-ethyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide.
| Compound Name | N'-(1,3-benzodioxol-4-ylmethyl)-N-ethyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119131964 |
| Molecular Formula | C20H28N4O4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | N'-(1,3-benzodioxol-4-ylmethyl)-N-ethyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1cccc2c1OCO2)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C20H28N4O4/c1-2-21-20(22-13-15-5-3-6-16-18(15)28-14-27-16)24-10-8-23(9-11-24)19(25)17-7-4-12-26-17/h3,5-6,17H,2,4,7-14H2,1H3,(H,21,22) |
| InChIKey | XVQKTJNCNMBBLS-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|