C17H23FN6 — CID 119132082
3-cyclopropyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[(4-fluorophenyl)methyl]-1-methylguanidine (PubChem CID 119132082) has the molecular formula C17H23FN6 and a molecular weight of 330.41 g/mol. Its IUPAC name is 3-cyclopropyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[(4-fluorophenyl)methyl]-1-methylguanidine.
| Compound Name | 3-cyclopropyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[(4-fluorophenyl)methyl]-1-methylguanidine |
|---|---|
| PubChem CID | 119132082 |
| Molecular Formula | C17H23FN6 |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | 3-cyclopropyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[(4-fluorophenyl)methyl]-1-methylguanidine |
| SMILES | Cc1nnc(C/N=C(/NC2CC2)N(C)Cc2ccc(F)cc2)n1C |
| InChI | InChI=1S/C17H23FN6/c1-12-21-22-16(24(12)3)10-19-17(20-15-8-9-15)23(2)11-13-4-6-14(18)7-5-13/h4-7,15H,8-11H2,1-3H3,(H,19,20) |
| InChIKey | CCRVBKWMRNYCNO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|