C12H21BrIN3S2 — CID 119141200
1-[(5-bromothiophen-3-yl)methyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine;hydroiodide (PubChem CID 119141200) has the molecular formula C12H21BrIN3S2 and a molecular weight of 478.26 g/mol. Its IUPAC name is 1-[(5-bromothiophen-3-yl)methyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[(5-bromothiophen-3-yl)methyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119141200 |
| Molecular Formula | C12H21BrIN3S2 |
| Molecular Weight | 478.26 g/mol |
| Exact Mass | 476.94 |
| IUPAC Name | 1-[(5-bromothiophen-3-yl)methyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1csc(Br)c1)NCC(C)(C)SC.I |
| InChI | InChI=1S/C12H20BrN3S2.HI/c1-12(2,17-4)8-16-11(14-3)15-6-9-5-10(13)18-7-9;/h5,7H,6,8H2,1-4H3,(H2,14,15,16);1H |
| InChIKey | BGSNTMSOILTQAQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.26 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|