C17H27IN4S — CID 119142416
1-(2,3-dihydro-1H-inden-5-yl)-2-[[3-(dimethylamino)thiolan-3-yl]methyl]guanidine;hydroiodide (PubChem CID 119142416) has the molecular formula C17H27IN4S and a molecular weight of 446.40 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-2-[[3-(dimethylamino)thiolan-3-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[[3-(dimethylamino)thiolan-3-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119142416 |
| Molecular Formula | C17H27IN4S |
| Molecular Weight | 446.40 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[[3-(dimethylamino)thiolan-3-yl]methyl]guanidine;hydroiodide |
| SMILES | CN(C)C1(C/N=C(\N)Nc2ccc3c(c2)CCC3)CCSC1.I |
| InChI | InChI=1S/C17H26N4S.HI/c1-21(2)17(8-9-22-12-17)11-19-16(18)20-15-7-6-13-4-3-5-14(13)10-15;/h6-7,10H,3-5,8-9,11-12H2,1-2H3,(H3,18,19,20);1H |
| InChIKey | KPZIADLUFXYFKM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|