C17H20ClF2IN6O — CID 119145914
N'-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 119145914) has the molecular formula C17H20ClF2IN6O and a molecular weight of 524.74 g/mol. Its IUPAC name is N'-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119145914 |
| Molecular Formula | C17H20ClF2IN6O |
| Molecular Weight | 524.74 g/mol |
| Exact Mass | 524.04 |
| IUPAC Name | N'-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\Cc1cc(Cl)ccc1OC(F)F)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C17H19ClF2N6O.HI/c18-13-2-3-14(27-15(19)20)12(10-13)11-24-16(21)25-6-8-26(9-7-25)17-22-4-1-5-23-17;/h1-5,10,15H,6-9,11H2,(H2,21,24);1H |
| InChIKey | WBLUEGXLTCTDKN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.74 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|