C19H22N6O — CID 119147440
N'-[(2-prop-2-ynoxyphenyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide (PubChem CID 119147440) has the molecular formula C19H22N6O and a molecular weight of 350.43 g/mol. Its IUPAC name is N'-[(2-prop-2-ynoxyphenyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N'-[(2-prop-2-ynoxyphenyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119147440 |
| Molecular Formula | C19H22N6O |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | N'-[(2-prop-2-ynoxyphenyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
| SMILES | C#CCOc1ccccc1C/N=C(\N)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C19H22N6O/c1-2-14-26-17-7-4-3-6-16(17)15-23-18(20)24-10-12-25(13-11-24)19-21-8-5-9-22-19/h1,3-9H,10-15H2,(H2,20,23) |
| InChIKey | XOJBKFFVSOWEFO-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|