C16H18ClFN4S — CID 119146189
1-[2-(2-chloro-6-fluorophenyl)cyclopropyl]-2-methyl-3-[(4-methyl-1,3-thiazol-2-yl)methyl]guanidine (PubChem CID 119146189) has the molecular formula C16H18ClFN4S and a molecular weight of 352.87 g/mol. Its IUPAC name is 1-[2-(2-chloro-6-fluorophenyl)cyclopropyl]-2-methyl-3-[(4-methyl-1,3-thiazol-2-yl)methyl]guanidine.
| Compound Name | 1-[2-(2-chloro-6-fluorophenyl)cyclopropyl]-2-methyl-3-[(4-methyl-1,3-thiazol-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 119146189 |
| Molecular Formula | C16H18ClFN4S |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 1-[2-(2-chloro-6-fluorophenyl)cyclopropyl]-2-methyl-3-[(4-methyl-1,3-thiazol-2-yl)methyl]guanidine |
| SMILES | C/N=C(\NCc1nc(C)cs1)NC1CC1c1c(F)cccc1Cl |
| InChI | InChI=1S/C16H18ClFN4S/c1-9-8-23-14(21-9)7-20-16(19-2)22-13-6-10(13)15-11(17)4-3-5-12(15)18/h3-5,8,10,13H,6-7H2,1-2H3,(H2,19,20,22) |
| InChIKey | JUYBCGNCZCUKSQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|