C16H21BrN6 — CID 119153963
1-[2-(4-bromophenyl)ethyl]-2-methyl-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine (PubChem CID 119153963) has the molecular formula C16H21BrN6 and a molecular weight of 377.29 g/mol. Its IUPAC name is 1-[2-(4-bromophenyl)ethyl]-2-methyl-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine.
| Compound Name | 1-[2-(4-bromophenyl)ethyl]-2-methyl-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine |
|---|---|
| PubChem CID | 119153963 |
| Molecular Formula | C16H21BrN6 |
| Molecular Weight | 377.29 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 1-[2-(4-bromophenyl)ethyl]-2-methyl-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine |
| SMILES | C/N=C(\NCCc1ccc(Br)cc1)NC1CCc2ncnn2C1 |
| InChI | InChI=1S/C16H21BrN6/c1-18-16(19-9-8-12-2-4-13(17)5-3-12)22-14-6-7-15-20-11-21-23(15)10-14/h2-5,11,14H,6-10H2,1H3,(H2,18,19,22) |
| InChIKey | NLLVYXFURKIZLM-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|