C17H21F3N6O — CID 119157158
2-methyl-1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-(3,3,3-trifluoro-2-hydroxy-2-phenylpropyl)guanidine (PubChem CID 119157158) has the molecular formula C17H21F3N6O and a molecular weight of 382.39 g/mol. Its IUPAC name is 2-methyl-1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-(3,3,3-trifluoro-2-hydroxy-2-phenylpropyl)guanidine.
| Compound Name | 2-methyl-1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-(3,3,3-trifluoro-2-hydroxy-2-phenylpropyl)guanidine |
|---|---|
| PubChem CID | 119157158 |
| Molecular Formula | C17H21F3N6O |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 2-methyl-1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-(3,3,3-trifluoro-2-hydroxy-2-phenylpropyl)guanidine |
| SMILES | C/N=C(\NCC(O)(c1ccccc1)C(F)(F)F)NC1CCc2ncnn2C1 |
| InChI | InChI=1S/C17H21F3N6O/c1-21-15(25-13-7-8-14-23-11-24-26(14)9-13)22-10-16(27,17(18,19)20)12-5-3-2-4-6-12/h2-6,11,13,27H,7-10H2,1H3,(H2,21,22,25) |
| InChIKey | ZTCRCOCQUYDZJZ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|