C19H23IN4OS — CID 119158156
1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[(5-phenylfuran-2-yl)methyl]guanidine;hydroiodide (PubChem CID 119158156) has the molecular formula C19H23IN4OS and a molecular weight of 482.39 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[(5-phenylfuran-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[(5-phenylfuran-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119158156 |
| Molecular Formula | C19H23IN4OS |
| Molecular Weight | 482.39 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[(5-phenylfuran-2-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(-c2ccccc2)o1)NCc1nc(C)c(C)s1.I |
| InChI | InChI=1S/C19H22N4OS.HI/c1-13-14(2)25-18(23-13)12-22-19(20-3)21-11-16-9-10-17(24-16)15-7-5-4-6-8-15;/h4-10H,11-12H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | USGAUJXZQSANEH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.39 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|