C22H31IN6O — CID 119161993
1-[2-(2-methoxyphenyl)-2-methylcyclopropyl]-2-methyl-3-(1-pyrimidin-2-ylpiperidin-3-yl)guanidine;hydroiodide (PubChem CID 119161993) has the molecular formula C22H31IN6O and a molecular weight of 522.44 g/mol. Its IUPAC name is 1-[2-(2-methoxyphenyl)-2-methylcyclopropyl]-2-methyl-3-(1-pyrimidin-2-ylpiperidin-3-yl)guanidine;hydroiodide.
| Compound Name | 1-[2-(2-methoxyphenyl)-2-methylcyclopropyl]-2-methyl-3-(1-pyrimidin-2-ylpiperidin-3-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119161993 |
| Molecular Formula | C22H31IN6O |
| Molecular Weight | 522.44 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | 1-[2-(2-methoxyphenyl)-2-methylcyclopropyl]-2-methyl-3-(1-pyrimidin-2-ylpiperidin-3-yl)guanidine;hydroiodide |
| SMILES | C/N=C(/NC1CCCN(c2ncccn2)C1)NC1CC1(C)c1ccccc1OC.I |
| InChI | InChI=1S/C22H30N6O.HI/c1-22(17-9-4-5-10-18(17)29-3)14-19(22)27-20(23-2)26-16-8-6-13-28(15-16)21-24-11-7-12-25-21;/h4-5,7,9-12,16,19H,6,8,13-15H2,1-3H3,(H2,23,26,27);1H |
| InChIKey | ZOOQXWCWFKVMJD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 74.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|