C18H20F3N3O3 — CID 119165926
2-[[1-tert-butyl-5-(trifluoromethyl)pyrazole-4-carbonyl]amino]-3-phenylpropanoic acid (PubChem CID 119165926) has the molecular formula C18H20F3N3O3 and a molecular weight of 383.37 g/mol. Its IUPAC name is 2-[[1-tert-butyl-5-(trifluoromethyl)pyrazole-4-carbonyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[1-tert-butyl-5-(trifluoromethyl)pyrazole-4-carbonyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 119165926 |
| Molecular Formula | C18H20F3N3O3 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 2-[[1-tert-butyl-5-(trifluoromethyl)pyrazole-4-carbonyl]amino]-3-phenylpropanoic acid |
| SMILES | CC(C)(C)n1ncc(C(=O)NC(Cc2ccccc2)C(=O)O)c1C(F)(F)F |
| InChI | InChI=1S/C18H20F3N3O3/c1-17(2,3)24-14(18(19,20)21)12(10-22-24)15(25)23-13(16(26)27)9-11-7-5-4-6-8-11/h4-8,10,13H,9H2,1-3H3,(H,23,25)(H,26,27) |
| InChIKey | WVAVUEFDJLMKMJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |