C15H20N2O6S — CID 119172636
4-[[2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetyl]-methylamino]butanoic acid (PubChem CID 119172636) has the molecular formula C15H20N2O6S and a molecular weight of 356.40 g/mol. Its IUPAC name is 4-[[2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetyl]-methylamino]butanoic acid.
| Compound Name | 4-[[2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetyl]-methylamino]butanoic acid |
|---|---|
| PubChem CID | 119172636 |
| Molecular Formula | C15H20N2O6S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 4-[[2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetyl]-methylamino]butanoic acid |
| SMILES | COc1ccc(CSCC(=O)N(C)CCCC(=O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H20N2O6S/c1-16(7-3-4-15(19)20)14(18)10-24-9-11-5-6-13(23-2)12(8-11)17(21)22/h5-6,8H,3-4,7,9-10H2,1-2H3,(H,19,20) |
| InChIKey | SZDKUAUBRFJWDW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|