C17H22N2O6S — CID 119182153
5-[2-(cyclohex-3-en-1-ylmethylcarbamoyl)pyrrolidin-1-yl]sulfonylfuran-2-carboxylic acid (PubChem CID 119182153) has the molecular formula C17H22N2O6S and a molecular weight of 382.44 g/mol. Its IUPAC name is 5-[2-(cyclohex-3-en-1-ylmethylcarbamoyl)pyrrolidin-1-yl]sulfonylfuran-2-carboxylic acid.
| Compound Name | 5-[2-(cyclohex-3-en-1-ylmethylcarbamoyl)pyrrolidin-1-yl]sulfonylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 119182153 |
| Molecular Formula | C17H22N2O6S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 5-[2-(cyclohex-3-en-1-ylmethylcarbamoyl)pyrrolidin-1-yl]sulfonylfuran-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)N2CCCC2C(=O)NCC2CC=CCC2)o1 |
| InChI | InChI=1S/C17H22N2O6S/c20-16(18-11-12-5-2-1-3-6-12)13-7-4-10-19(13)26(23,24)15-9-8-14(25-15)17(21)22/h1-2,8-9,12-13H,3-7,10-11H2,(H,18,20)(H,21,22) |
| InChIKey | NCVBNSMIQVNIPY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|