C16H21F3N2O7S — CID 55650936
ethyl 5-[2-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]pyrrolidin-1-yl]sulfonylfuran-2-carboxylate (PubChem CID 55650936) has the molecular formula C16H21F3N2O7S and a molecular weight of 442.41 g/mol. Its IUPAC name is ethyl 5-[2-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]pyrrolidin-1-yl]sulfonylfuran-2-carboxylate.
| Compound Name | ethyl 5-[2-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]pyrrolidin-1-yl]sulfonylfuran-2-carboxylate |
|---|---|
| PubChem CID | 55650936 |
| Molecular Formula | C16H21F3N2O7S |
| Molecular Weight | 442.41 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | ethyl 5-[2-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]pyrrolidin-1-yl]sulfonylfuran-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)N2CCCC2C(=O)NCCOCC(F)(F)F)o1 |
| InChI | InChI=1S/C16H21F3N2O7S/c1-2-27-15(23)12-5-6-13(28-12)29(24,25)21-8-3-4-11(21)14(22)20-7-9-26-10-16(17,18)19/h5-6,11H,2-4,7-10H2,1H3,(H,20,22) |
| InChIKey | JXBBXZDDKWHCDL-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.41 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|