C16H22N2O7S — CID 120695944
5-[2-(2-but-3-enoxyethylcarbamoyl)pyrrolidin-1-yl]sulfonylfuran-2-carboxylic acid (PubChem CID 120695944) has the molecular formula C16H22N2O7S and a molecular weight of 386.43 g/mol. Its IUPAC name is 5-[2-(2-but-3-enoxyethylcarbamoyl)pyrrolidin-1-yl]sulfonylfuran-2-carboxylic acid.
| Compound Name | 5-[2-(2-but-3-enoxyethylcarbamoyl)pyrrolidin-1-yl]sulfonylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 120695944 |
| Molecular Formula | C16H22N2O7S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 5-[2-(2-but-3-enoxyethylcarbamoyl)pyrrolidin-1-yl]sulfonylfuran-2-carboxylic acid |
| SMILES | C=CCCOCCNC(=O)C1CCCN1S(=O)(=O)c1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C16H22N2O7S/c1-2-3-10-24-11-8-17-15(19)12-5-4-9-18(12)26(22,23)14-7-6-13(25-14)16(20)21/h2,6-7,12H,1,3-5,8-11H2,(H,17,19)(H,20,21) |
| InChIKey | JAGWDXWIYVMVHI-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|