C18H22N4O5 — CID 119201944
2-[3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoylamino]-2-phenylbutanoic acid (PubChem CID 119201944) has the molecular formula C18H22N4O5 and a molecular weight of 374.40 g/mol. Its IUPAC name is 2-[3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoylamino]-2-phenylbutanoic acid.
| Compound Name | 2-[3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoylamino]-2-phenylbutanoic acid |
|---|---|
| PubChem CID | 119201944 |
| Molecular Formula | C18H22N4O5 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 2-[3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoylamino]-2-phenylbutanoic acid |
| SMILES | CCC(NC(=O)CCn1nc(C)c([N+](=O)[O-])c1C)(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C18H22N4O5/c1-4-18(17(24)25,14-8-6-5-7-9-14)19-15(23)10-11-21-13(3)16(22(26)27)12(2)20-21/h5-9H,4,10-11H2,1-3H3,(H,19,23)(H,24,25) |
| InChIKey | FGUGFWKLZNOMCI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|